C24H17N3O3 — CID 137019055
2-(4-methoxyphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one (PubChem CID 137019055) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one.
| Compound Name | 2-(4-methoxyphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
|---|---|
| PubChem CID | 137019055 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-20-oxa-5,6,12-triazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),6,9,14,16,18-octaen-21-one |
| SMILES | COc1ccc(C2c3c(c4ccccc4oc3=O)Nc3ccc4cn[nH]c4c32)cc1 |
| InChI | InChI=1S/C24H17N3O3/c1-29-15-9-6-13(7-10-15)19-20-17(11-8-14-12-25-27-22(14)20)26-23-16-4-2-3-5-18(16)30-24(28)21(19)23/h2-12,19,26H,1H3,(H,25,27) |
| InChIKey | NJIFSGCYVXYTNM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|