C23H32FN7O3S — CID 137019665
1-[(1-pyridazin-3-ylpyrrolidin-3-yl)amino]propyl N'-amino-N-[2-ethoxy-2-(4-fluoro-3-methoxyphenyl)acetyl]carbamimidothioate (PubChem CID 137019665) has the molecular formula C23H32FN7O3S and a molecular weight of 505.62 g/mol. Its IUPAC name is 1-[(1-pyridazin-3-ylpyrrolidin-3-yl)amino]propyl N'-amino-N-[2-ethoxy-2-(4-fluoro-3-methoxyphenyl)acetyl]carbamimidothioate.
| Compound Name | 1-[(1-pyridazin-3-ylpyrrolidin-3-yl)amino]propyl N'-amino-N-[2-ethoxy-2-(4-fluoro-3-methoxyphenyl)acetyl]carbamimidothioate |
|---|---|
| PubChem CID | 137019665 |
| Molecular Formula | C23H32FN7O3S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 1-[(1-pyridazin-3-ylpyrrolidin-3-yl)amino]propyl N'-amino-N-[2-ethoxy-2-(4-fluoro-3-methoxyphenyl)acetyl]carbamimidothioate |
| SMILES | CCOC(C(=O)NC(=NN)SC(CC)NC1CCN(c2cccnn2)C1)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C23H32FN7O3S/c1-4-20(27-16-10-12-31(14-16)19-7-6-11-26-30-19)35-23(29-25)28-22(32)21(34-5-2)15-8-9-17(24)18(13-15)33-3/h6-9,11,13,16,20-21,27H,4-5,10,12,14,25H2,1-3H3,(H,28,29,32) |
| InChIKey | FYLFWCATGAYEKR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|