C26H17BrN2O4S2 — CID 137021131
[4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-2-sulfonate (PubChem CID 137021131) has the molecular formula C26H17BrN2O4S2 and a molecular weight of 565.47 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 137021131 |
| Molecular Formula | C26H17BrN2O4S2 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | [4-[(Z)-[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] naphthalene-2-sulfonate |
| SMILES | O=C1N/C(=N\c2ccc(Br)cc2)S/C1=C\c1ccc(OS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H17BrN2O4S2/c27-20-8-10-21(11-9-20)28-26-29-25(30)24(34-26)15-17-5-12-22(13-6-17)33-35(31,32)23-14-7-18-3-1-2-4-19(18)16-23/h1-16H,(H,28,29,30)/b24-15- |
| InChIKey | KGUZVJVDZVFWOP-IWIPYMOSSA-N |
| XLogP | 6.26 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|