C20H16FN5O2 — CID 137021902
3-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-6-(4-fluorophenyl)quinazolin-4-one (PubChem CID 137021902) has the molecular formula C20H16FN5O2 and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-6-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 3-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-6-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137021902 |
| Molecular Formula | C20H16FN5O2 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-[2-(4-amino-6-oxo-1H-pyrimidin-2-yl)ethyl]-6-(4-fluorophenyl)quinazolin-4-one |
| SMILES | Nc1cc(=O)[nH]c(CCn2cnc3ccc(-c4ccc(F)cc4)cc3c2=O)n1 |
| InChI | InChI=1S/C20H16FN5O2/c21-14-4-1-12(2-5-14)13-3-6-16-15(9-13)20(28)26(11-23-16)8-7-18-24-17(22)10-19(27)25-18/h1-6,9-11H,7-8H2,(H3,22,24,25,27) |
| InChIKey | UWRUCFFSGWRZAW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |