About [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate
[(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate (PubChem CID 137021971) has the molecular formula C20H22N2O4S
and a molecular weight of 386.47 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate.
Molecular Properties
| Compound Name | [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate |
| PubChem CID | 137021971 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate |
| SMILES | CCc1cccc2c1N=CC2=Cc1sc(=O)n(CC(=O)O[C@H](C)CC)c1O |
| InChI | InChI=1S/C20H22N2O4S/c1-4-12(3)26-17(23)11-22-19(24)16(27-20(22)25)9-14-10-21-18-13(5-2)7-6-8-15(14)18/h6-10,12,24H,4-5,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | FHLMCUXNOHXYSV-GFCCVEGCSA-N |
| XLogP | 3.78 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate?
The IUPAC name of [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate (CID 137021971) is [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate.
What is the SMILES notation for [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate?
The canonical SMILES for [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate is CCc1cccc2c1N=CC2=Cc1sc(=O)n(CC(=O)O[C@H](C)CC)c1O.
What is the InChIKey of [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate?
The InChIKey is FHLMCUXNOHXYSV-GFCCVEGCSA-N. The full InChI is InChI=1S/C20H22N2O4S/c1-4-12(3)26-17(23)11-22-19(24)16(27-20(22)25)9-14-10-21-18-13(5-2)7-6-8-15(14)18/h6-10,12,24H,4-5,11H2,1-3H3/t12-/m1/s1.
What are the key properties of [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate?
[(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate has a molecular weight of 386.47 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-butan-2-yl] 2-[5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-oxo-1,3-thiazol-3-yl]acetate is sourced from PubChem (CID 137021971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).