C16H15BrFN3O3 — CID 137022207
N-[(Z)-(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide (PubChem CID 137022207) has the molecular formula C16H15BrFN3O3 and a molecular weight of 396.22 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 137022207 |
| Molecular Formula | C16H15BrFN3O3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[(Z)-(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-2-(4-fluoroanilino)acetamide |
| SMILES | COc1cc(Br)c(O)c(/C=N\NC(=O)CNc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H15BrFN3O3/c1-24-13-6-10(16(23)14(17)7-13)8-20-21-15(22)9-19-12-4-2-11(18)3-5-12/h2-8,19,23H,9H2,1H3,(H,21,22)/b20-8- |
| InChIKey | GYLAZESTDQIYMD-ZBKNUEDVSA-N |
| XLogP | 2.86 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|