C22H29ClF2N6O5 — CID 137025735
tert-butyl 4-[3-[(E)-N-(3,3-difluorocyclobutanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride (PubChem CID 137025735) has the molecular formula C22H29ClF2N6O5 and a molecular weight of 530.96 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-N-(3,3-difluorocyclobutanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-[3-[(E)-N-(3,3-difluorocyclobutanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 137025735 |
| Molecular Formula | C22H29ClF2N6O5 |
| Molecular Weight | 530.96 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | tert-butyl 4-[3-[(E)-N-(3,3-difluorocyclobutanecarbonyl)-N'-hydroxycarbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)[nH]c3c(/C(=N\O)NC(=O)C4CC(F)(F)C4)cnn23)CC1.Cl |
| InChI | InChI=1S/C22H28F2N6O5.ClH/c1-21(2,3)35-20(33)29-6-4-12(5-7-29)15-8-16(31)26-18-14(11-25-30(15)18)17(28-34)27-19(32)13-9-22(23,24)10-13;/h8,11-13,34H,4-7,9-10H2,1-3H3,(H,26,31)(H,27,28,32);1H |
| InChIKey | MPUKZWLJJKOYDO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.96 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|