About 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride
3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride (PubChem CID 137025966) has the molecular formula C14H22ClN5O
and a molecular weight of 311.82 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride |
| PubChem CID | 137025966 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride |
| SMILES | CN(C)Cc1cnn2c(C3CCNCC3)cc(=O)[nH]c12.Cl |
| InChI | InChI=1S/C14H21N5O.ClH/c1-18(2)9-11-8-16-19-12(7-13(20)17-14(11)19)10-3-5-15-6-4-10;/h7-8,10,15H,3-6,9H2,1-2H3,(H,17,20);1H |
| InChIKey | CVELNYZJGBJNIF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The IUPAC name of 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride (CID 137025966) is 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride.
What is the SMILES notation for 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The canonical SMILES for 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride is CN(C)Cc1cnn2c(C3CCNCC3)cc(=O)[nH]c12.Cl.
What is the InChIKey of 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The InChIKey is CVELNYZJGBJNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O.ClH/c1-18(2)9-11-8-16-19-12(7-13(20)17-14(11)19)10-3-5-15-6-4-10;/h7-8,10,15H,3-6,9H2,1-2H3,(H,17,20);1H.
What are the key properties of 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride has a molecular weight of 311.82 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(dimethylamino)methyl]-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride is sourced from PubChem (CID 137025966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).