C10H10N4O — CID 137027827
methyl 3-pyridin-3-yl-1H-pyrazole-5-carboximidate (PubChem CID 137027827) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is methyl 3-pyridin-3-yl-1H-pyrazole-5-carboximidate.
| Compound Name | methyl 3-pyridin-3-yl-1H-pyrazole-5-carboximidate |
|---|---|
| PubChem CID | 137027827 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | methyl 3-pyridin-3-yl-1H-pyrazole-5-carboximidate |
| SMILES | [H]/N=C(\OC)c1cc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C10H10N4O/c1-15-10(11)9-5-8(13-14-9)7-3-2-4-12-6-7/h2-6,11H,1H3,(H,13,14)/b11-10- |
| InChIKey | DMGLBKZIFQVKAS-KHPPLWFESA-N |
| XLogP | 1.44 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|