C20H21ClFN5O3 — CID 137028055
(5R)-N-(3-chloro-4-fluorophenyl)-2-[(2R)-2-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 137028055) has the molecular formula C20H21ClFN5O3 and a molecular weight of 433.87 g/mol. Its IUPAC name is (5R)-N-(3-chloro-4-fluorophenyl)-2-[(2R)-2-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(3-chloro-4-fluorophenyl)-2-[(2R)-2-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137028055 |
| Molecular Formula | C20H21ClFN5O3 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (5R)-N-(3-chloro-4-fluorophenyl)-2-[(2R)-2-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C[C@@H]1CCCCN1c1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1ccc(F)c(Cl)c1)CC(=O)N2 |
| InChI | InChI=1S/C20H21ClFN5O3/c1-10-4-2-3-7-27(10)20-25-17-16(19(30)26-20)12(9-15(28)24-17)18(29)23-11-5-6-14(22)13(21)8-11/h5-6,8,10,12H,2-4,7,9H2,1H3,(H,23,29)(H2,24,25,26,28,30)/t10-,12-/m1/s1 |
| InChIKey | JJZDTXPMYSUVLI-ZYHUDNBSSA-N |
| XLogP | 3.01 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |