About 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol
4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 137028416) has the molecular formula C21H16N2O2
and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| PubChem CID | 137028416 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3ccc(Cc4ccccc4)cc3)no2)cc1 |
| InChI | InChI=1S/C21H16N2O2/c24-19-12-10-18(11-13-19)21-22-20(23-25-21)17-8-6-16(7-9-17)14-15-4-2-1-3-5-15/h1-13,24H,14H2 |
| InChIKey | IASMFSCKZATQIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol?
The IUPAC name of 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol (CID 137028416) is 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol.
What is the SMILES notation for 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol?
The canonical SMILES for 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol is Oc1ccc(-c2nc(-c3ccc(Cc4ccccc4)cc3)no2)cc1.
What is the InChIKey of 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol?
The InChIKey is IASMFSCKZATQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c24-19-12-10-18(11-13-19)21-22-20(23-25-21)17-8-6-16(7-9-17)14-15-4-2-1-3-5-15/h1-13,24H,14H2.
What are the key properties of 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol?
4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol has a molecular weight of 328.37 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-benzylphenyl)-1,2,4-oxadiazol-5-yl]phenol is sourced from PubChem (CID 137028416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).