C23H27N5O — CID 137029387
2-[6-amino-5-(4-benzyl-3,5-dimethylpiperazin-1-yl)pyridazin-3-yl]phenol (PubChem CID 137029387) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[6-amino-5-(4-benzyl-3,5-dimethylpiperazin-1-yl)pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-(4-benzyl-3,5-dimethylpiperazin-1-yl)pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029387 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[6-amino-5-(4-benzyl-3,5-dimethylpiperazin-1-yl)pyridazin-3-yl]phenol |
| SMILES | CC1CN(c2cc(-c3ccccc3O)nnc2N)CC(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H27N5O/c1-16-13-27(14-17(2)28(16)15-18-8-4-3-5-9-18)21-12-20(25-26-23(21)24)19-10-6-7-11-22(19)29/h3-12,16-17,29H,13-15H2,1-2H3,(H2,24,26) |
| InChIKey | IYEFXJIOVKGYQQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |