About 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol
2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol (PubChem CID 137029397) has the molecular formula C22H22N4O
and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol |
| PubChem CID | 137029397 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1C1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N4O/c23-22-19(14-20(24-25-22)18-8-4-5-9-21(18)27)17-10-12-26(13-11-17)15-16-6-2-1-3-7-16/h1-10,14,27H,11-13,15H2,(H2,23,25) |
| InChIKey | NXPRAEIFHKRCER-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol?
The IUPAC name of 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol (CID 137029397) is 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol.
What is the SMILES notation for 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol?
The canonical SMILES for 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol is Nc1nnc(-c2ccccc2O)cc1C1=CCN(Cc2ccccc2)CC1.
What is the InChIKey of 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol?
The InChIKey is NXPRAEIFHKRCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c23-22-19(14-20(24-25-22)18-8-4-5-9-21(18)27)17-10-12-26(13-11-17)15-16-6-2-1-3-7-16/h1-10,14,27H,11-13,15H2,(H2,23,25).
What are the key properties of 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol?
2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol has a molecular weight of 358.45 g/mol, XLogP of 3.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-5-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)pyridazin-3-yl]phenol is sourced from PubChem (CID 137029397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).