C15H16F3N5O — CID 137029403
2-[6-amino-5-[3-(trifluoromethyl)piperazin-1-yl]pyridazin-3-yl]phenol (PubChem CID 137029403) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is 2-[6-amino-5-[3-(trifluoromethyl)piperazin-1-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[3-(trifluoromethyl)piperazin-1-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029403 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[6-amino-5-[3-(trifluoromethyl)piperazin-1-yl]pyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1N1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F3N5O/c16-15(17,18)13-8-23(6-5-20-13)11-7-10(21-22-14(11)19)9-3-1-2-4-12(9)24/h1-4,7,13,20,24H,5-6,8H2,(H2,19,22) |
| InChIKey | CFDJFIHBLGQROE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |