C22H24N4O2 — CID 137029516
2-[6-amino-5-(1-benzylpiperidin-3-yl)oxypyridazin-3-yl]phenol (PubChem CID 137029516) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[6-amino-5-(1-benzylpiperidin-3-yl)oxypyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-(1-benzylpiperidin-3-yl)oxypyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029516 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[6-amino-5-(1-benzylpiperidin-3-yl)oxypyridazin-3-yl]phenol |
| SMILES | Nc1nnc(-c2ccccc2O)cc1OC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H24N4O2/c23-22-21(13-19(24-25-22)18-10-4-5-11-20(18)27)28-17-9-6-12-26(15-17)14-16-7-2-1-3-8-16/h1-5,7-8,10-11,13,17,27H,6,9,12,14-15H2,(H2,23,25) |
| InChIKey | FIIMUDFZQPQRSB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |