About 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol
2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol (PubChem CID 137029576) has the molecular formula C23H27FN6O
and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol |
| PubChem CID | 137029576 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol |
| SMILES | CCC1CN(c2cc(-c3ccccc3O)nnc2N)CC(CC)N1c1cncc(F)c1 |
| InChI | InChI=1S/C23H27FN6O/c1-3-16-13-29(14-17(4-2)30(16)18-9-15(24)11-26-12-18)21-10-20(27-28-23(21)25)19-7-5-6-8-22(19)31/h5-12,16-17,31H,3-4,13-14H2,1-2H3,(H2,25,28) |
| InChIKey | KLVGQCUKISIGJC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol?
The IUPAC name of 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol (CID 137029576) is 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol.
What is the SMILES notation for 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol?
The canonical SMILES for 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol is CCC1CN(c2cc(-c3ccccc3O)nnc2N)CC(CC)N1c1cncc(F)c1.
What is the InChIKey of 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol?
The InChIKey is KLVGQCUKISIGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN6O/c1-3-16-13-29(14-17(4-2)30(16)18-9-15(24)11-26-12-18)21-10-20(27-28-23(21)25)19-7-5-6-8-22(19)31/h5-12,16-17,31H,3-4,13-14H2,1-2H3,(H2,25,28).
What are the key properties of 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol?
2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol has a molecular weight of 422.51 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-5-[3,5-diethyl-4-(5-fluoro-3-pyridinyl)piperazin-1-yl]pyridazin-3-yl]phenol is sourced from PubChem (CID 137029576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).