C19H21FN6O — CID 137029578
2-[6-amino-5-[2-[(5-fluoro-2-pyridinyl)amino]butylamino]pyridazin-3-yl]phenol (PubChem CID 137029578) has the molecular formula C19H21FN6O and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[6-amino-5-[2-[(5-fluoro-2-pyridinyl)amino]butylamino]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[2-[(5-fluoro-2-pyridinyl)amino]butylamino]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029578 |
| Molecular Formula | C19H21FN6O |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[6-amino-5-[2-[(5-fluoro-2-pyridinyl)amino]butylamino]pyridazin-3-yl]phenol |
| SMILES | CCC(CNc1cc(-c2ccccc2O)nnc1N)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C19H21FN6O/c1-2-13(24-18-8-7-12(20)10-23-18)11-22-16-9-15(25-26-19(16)21)14-5-3-4-6-17(14)27/h3-10,13,27H,2,11H2,1H3,(H2,21,26)(H,22,25)(H,23,24) |
| InChIKey | ABQMAEIGVAYINF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |