C23H23F2N5O2 — CID 137030187
4-[[5-[(tert-butylamino)-hydroxymethyl]-2-pyridinyl]amino]-2-(2,6-difluorophenyl)-6H-pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137030187) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-[[5-[(tert-butylamino)-hydroxymethyl]-2-pyridinyl]amino]-2-(2,6-difluorophenyl)-6H-pyrrolo[3,4-b]pyridin-5-ol.
| Compound Name | 4-[[5-[(tert-butylamino)-hydroxymethyl]-2-pyridinyl]amino]-2-(2,6-difluorophenyl)-6H-pyrrolo[3,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 137030187 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-[[5-[(tert-butylamino)-hydroxymethyl]-2-pyridinyl]amino]-2-(2,6-difluorophenyl)-6H-pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | CC(C)(C)NC(O)c1ccc(Nc2cc(-c3c(F)cccc3F)nc3c[nH]c(O)c23)nc1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-23(2,3)30-21(31)12-7-8-18(26-10-12)29-16-9-15(19-13(24)5-4-6-14(19)25)28-17-11-27-22(32)20(16)17/h4-11,21,27,30-32H,1-3H3,(H,26,29) |
| InChIKey | YLQUQMANWSZQEZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|