C14H17N3O2S — CID 137030456
2-methyl-4-[(3S)-4-(thiophen-3-ylmethyl)morpholin-3-yl]-1H-pyrimidin-6-one (PubChem CID 137030456) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-4-(thiophen-3-ylmethyl)morpholin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3S)-4-(thiophen-3-ylmethyl)morpholin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137030456 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-methyl-4-[(3S)-4-(thiophen-3-ylmethyl)morpholin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@H]2COCCN2Cc2ccsc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-15-12(6-14(18)16-10)13-8-19-4-3-17(13)7-11-2-5-20-9-11/h2,5-6,9,13H,3-4,7-8H2,1H3,(H,15,16,18)/t13-/m1/s1 |
| InChIKey | HFBRQHBRINWRAU-CYBMUJFWSA-N |
| XLogP | 1.71 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |