C23H25N5O3S2 — CID 137031089
N-[5-[[2-[2-methyl-4-(1-methylpyrrolidin-3-yl)oxyphenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]cyclopropanecarboxamide (PubChem CID 137031089) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[5-[[2-[2-methyl-4-(1-methylpyrrolidin-3-yl)oxyphenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[[2-[2-methyl-4-(1-methylpyrrolidin-3-yl)oxyphenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 137031089 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[5-[[2-[2-methyl-4-(1-methylpyrrolidin-3-yl)oxyphenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-1,3-thiazol-2-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(OC2CCN(C)C2)ccc1/N=C1/NC(=O)C(=Cc2cnc(NC(=O)C3CC3)s2)S1 |
| InChI | InChI=1S/C23H25N5O3S2/c1-13-9-15(31-16-7-8-28(2)12-16)5-6-18(13)25-23-27-21(30)19(33-23)10-17-11-24-22(32-17)26-20(29)14-3-4-14/h5-6,9-11,14,16H,3-4,7-8,12H2,1-2H3,(H,24,26,29)(H,25,27,30) |
| InChIKey | USZZPAPXDNSTKR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|