About 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol
2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137031188) has the molecular formula C19H14ClFN4O2
and a molecular weight of 384.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol |
| PubChem CID | 137031188 |
| Molecular Formula | C19H14ClFN4O2 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COc1ccc(Nc2cc(-c3c(F)cccc3Cl)nc3c[nH]c(O)c23)nc1 |
| InChI | InChI=1S/C19H14ClFN4O2/c1-27-10-5-6-16(22-8-10)25-14-7-13(17-11(20)3-2-4-12(17)21)24-15-9-23-19(26)18(14)15/h2-9,23,26H,1H3,(H,22,25) |
| InChIKey | DCRZBRADZMQNJG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The IUPAC name of 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol (CID 137031188) is 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The canonical SMILES for 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol is COc1ccc(Nc2cc(-c3c(F)cccc3Cl)nc3c[nH]c(O)c23)nc1.
What is the InChIKey of 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The InChIKey is DCRZBRADZMQNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClFN4O2/c1-27-10-5-6-16(22-8-10)25-14-7-13(17-11(20)3-2-4-12(17)21)24-15-9-23-19(26)18(14)15/h2-9,23,26H,1H3,(H,22,25).
What are the key properties of 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol has a molecular weight of 384.80 g/mol, XLogP of 4.88, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-6-fluorophenyl)-4-[(5-methoxy-2-pyridinyl)amino]-6H-pyrrolo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 137031188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).