C20H18N6O3 — CID 137031284
(4R)-8-methyl-2-(3-methylanilino)-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 137031284) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is (4R)-8-methyl-2-(3-methylanilino)-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | (4R)-8-methyl-2-(3-methylanilino)-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 137031284 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4R)-8-methyl-2-(3-methylanilino)-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1cccc(NC2=N[C@@H](c3ccccc3[N+](=O)[O-])n3c(nc(C)cc3=O)N2)c1 |
| InChI | InChI=1S/C20H18N6O3/c1-12-6-5-7-14(10-12)22-19-23-18(15-8-3-4-9-16(15)26(28)29)25-17(27)11-13(2)21-20(25)24-19/h3-11,18H,1-2H3,(H2,21,22,23,24)/t18-/m1/s1 |
| InChIKey | ZQGSDFJMUYEDNP-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|