About 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol
4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol (PubChem CID 137031994) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol.
Molecular Properties
| Compound Name | 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol |
| PubChem CID | 137031994 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol |
| SMILES | [H]/N=C1\CC(=N\[H])/C(=N/c2ccc(O)cc2)C=C1OCC |
| InChI | InChI=1S/C14H15N3O2/c1-2-19-14-8-13(11(15)7-12(14)16)17-9-3-5-10(18)6-4-9/h3-6,8,15-16,18H,2,7H2,1H3/b15-11+,16-12+,17-13+ |
| InChIKey | VCFNKYPSAZVHHE-GWZYDACJSA-N |
| XLogP | 2.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol?
The IUPAC name of 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol (CID 137031994) is 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol.
What is the SMILES notation for 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol?
The canonical SMILES for 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol is [H]/N=C1\CC(=N\[H])/C(=N/c2ccc(O)cc2)C=C1OCC.
What is the InChIKey of 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol?
The InChIKey is VCFNKYPSAZVHHE-GWZYDACJSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-2-19-14-8-13(11(15)7-12(14)16)17-9-3-5-10(18)6-4-9/h3-6,8,15-16,18H,2,7H2,1H3/b15-11+,16-12+,17-13+.
What are the key properties of 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol?
4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol has a molecular weight of 257.29 g/mol, XLogP of 2.83, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-ethoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]phenol is sourced from PubChem (CID 137031994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).