C20H20ClF3N6S — CID 137033666
N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 137033666) has the molecular formula C20H20ClF3N6S and a molecular weight of 468.94 g/mol. Its IUPAC name is N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137033666 |
| Molecular Formula | C20H20ClF3N6S |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(N2CCN(C(=S)N/N=C3/CCNc4c(Cl)ccnc43)CC2)c1 |
| InChI | InChI=1S/C20H20ClF3N6S/c21-15-4-6-26-18-16(5-7-25-17(15)18)27-28-19(31)30-10-8-29(9-11-30)14-3-1-2-13(12-14)20(22,23)24/h1-4,6,12,25H,5,7-11H2,(H,28,31)/b27-16- |
| InChIKey | NITNCDHCCFEVDA-YUMHPJSZSA-N |
| XLogP | 3.97 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|