C15H19F3N6S — CID 137033740
N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-(2,2,2-trifluoroethyl)piperazine-1-carbothioamide (PubChem CID 137033740) has the molecular formula C15H19F3N6S and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-(2,2,2-trifluoroethyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-(2,2,2-trifluoroethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137033740 |
| Molecular Formula | C15H19F3N6S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-(2,2,2-trifluoroethyl)piperazine-1-carbothioamide |
| SMILES | FC(F)(F)CN1CCN(C(=S)N/N=C2/CCNc3cccnc32)CC1 |
| InChI | InChI=1S/C15H19F3N6S/c16-15(17,18)10-23-6-8-24(9-7-23)14(25)22-21-12-3-5-19-11-2-1-4-20-13(11)12/h1-2,4,19H,3,5-10H2,(H,22,25)/b21-12- |
| InChIKey | HTTBLZALCUGZGN-MTJSOVHGSA-N |
| XLogP | 1.66 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|