C14H14N6S — CID 137033810
1-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-3-pyridin-3-ylthiourea (PubChem CID 137033810) has the molecular formula C14H14N6S and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 137033810 |
| Molecular Formula | C14H14N6S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-3-pyridin-3-ylthiourea |
| SMILES | S=C(N/N=C1/CCNc2cccnc21)Nc1cccnc1 |
| InChI | InChI=1S/C14H14N6S/c21-14(18-10-3-1-6-15-9-10)20-19-12-5-8-16-11-4-2-7-17-13(11)12/h1-4,6-7,9,16H,5,8H2,(H2,18,20,21)/b19-12- |
| InChIKey | HIEHDQULLJWLOI-UNOMPAQXSA-N |
| XLogP | 1.98 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|