C23H16FN3O4S — CID 137034526
(5E)-2-(4-fluorophenyl)imino-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137034526) has the molecular formula C23H16FN3O4S and a molecular weight of 449.46 g/mol. Its IUPAC name is (5E)-2-(4-fluorophenyl)imino-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-fluorophenyl)imino-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137034526 |
| Molecular Formula | C23H16FN3O4S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (5E)-2-(4-fluorophenyl)imino-5-[[4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(F)cc2)S/C1=C/c1ccc(OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H16FN3O4S/c24-17-6-8-18(9-7-17)25-23-26-22(28)21(32-23)13-15-4-10-20(11-5-15)31-14-16-2-1-3-19(12-16)27(29)30/h1-13H,14H2,(H,25,26,28)/b21-13+ |
| InChIKey | GZASRQOAILNPRB-FYJGNVAPSA-N |
| XLogP | 5.20 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|