C12H19N3O3 — CID 137034890
(Z)-3-hydroxy-1-morpholin-4-yl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-en-1-one (PubChem CID 137034890) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is (Z)-3-hydroxy-1-morpholin-4-yl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-1-morpholin-4-yl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 137034890 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | (Z)-3-hydroxy-1-morpholin-4-yl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-en-1-one |
| SMILES | C/C(O)=C(/C(=O)N1CCOCC1)C1=NCCCN1 |
| InChI | InChI=1S/C12H19N3O3/c1-9(16)10(11-13-3-2-4-14-11)12(17)15-5-7-18-8-6-15/h16H,2-8H2,1H3,(H,13,14)/b10-9- |
| InChIKey | AVKFXQKJWWQSRT-KTKRTIGZSA-N |
| XLogP | 0.07 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|