C10H17N3O2 — CID 137034910
(Z)-3-hydroxy-N,N-dimethyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide (PubChem CID 137034910) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is (Z)-3-hydroxy-N,N-dimethyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide.
| Compound Name | (Z)-3-hydroxy-N,N-dimethyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 137034910 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | (Z)-3-hydroxy-N,N-dimethyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)but-2-enamide |
| SMILES | C/C(O)=C(/C(=O)N(C)C)C1=NCCCN1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(14)8(10(15)13(2)3)9-11-5-4-6-12-9/h14H,4-6H2,1-3H3,(H,11,12)/b8-7- |
| InChIKey | QCIDRAXLWZPZOF-FPLPWBNLSA-N |
| XLogP | 0.30 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|