C27H27Cl2N7OS2 — CID 137034993
2,4-dichloro-6-[[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]sulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol (PubChem CID 137034993) has the molecular formula C27H27Cl2N7OS2 and a molecular weight of 600.60 g/mol. Its IUPAC name is 2,4-dichloro-6-[[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]sulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]sulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137034993 |
| Molecular Formula | C27H27Cl2N7OS2 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 2,4-dichloro-6-[[2-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]sulfanyl]-1,3-benzothiazol-6-yl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1ccc2nc(Sc3nc(N4CCCCC4)nc(N4CCCCC4)n3)sc2c1 |
| InChI | InChI=1S/C27H27Cl2N7OS2/c28-18-13-17(23(37)20(29)14-18)16-30-19-7-8-21-22(15-19)38-27(31-21)39-26-33-24(35-9-3-1-4-10-35)32-25(34-26)36-11-5-2-6-12-36/h7-8,13-16,37H,1-6,9-12H2/b30-16+ |
| InChIKey | TZTRAGMQSNGAFU-OKCVXOCRSA-N |
| XLogP | 7.38 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|