C7H8N2O2 — CID 137035386
3,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one (PubChem CID 137035386) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one.
| Compound Name | 3,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137035386 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3,5,6,8-tetrahydropyrano[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1CCOC2 |
| InChI | InChI=1S/C7H8N2O2/c10-7-5-1-2-11-3-6(5)8-4-9-7/h4H,1-3H2,(H,8,9,10) |
| InChIKey | XTKOENJDNIVJAQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |