C28H32F2N4O5S — CID 137036698
ethyl 2-[1-(2,4-difluorophenyl)-2-iminopropyl]-4-[4-(dipropylsulfamoyl)phenyl]-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 137036698) has the molecular formula C28H32F2N4O5S and a molecular weight of 574.65 g/mol. Its IUPAC name is ethyl 2-[1-(2,4-difluorophenyl)-2-iminopropyl]-4-[4-(dipropylsulfamoyl)phenyl]-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[1-(2,4-difluorophenyl)-2-iminopropyl]-4-[4-(dipropylsulfamoyl)phenyl]-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137036698 |
| Molecular Formula | C28H32F2N4O5S |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | ethyl 2-[1-(2,4-difluorophenyl)-2-iminopropyl]-4-[4-(dipropylsulfamoyl)phenyl]-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C(\C)C(c1nc(-c2ccc(S(=O)(=O)N(CCC)CCC)cc2)c(C(=O)OCC)c(=O)[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H32F2N4O5S/c1-5-14-34(15-6-2)40(37,38)20-11-8-18(9-12-20)25-24(28(36)39-7-3)27(35)33-26(32-25)23(17(4)31)21-13-10-19(29)16-22(21)30/h8-13,16,23,31H,5-7,14-15H2,1-4H3,(H,32,33,35)/b31-17+ |
| InChIKey | BIWOUDHQIACNHE-KBVAKVRCSA-N |
| XLogP | 4.87 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|