C26H19F3N6O — CID 137036863
N-[C-(2-amino-5-cyanophenyl)-N-phenylcarbonimidoyl]-3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 137036863) has the molecular formula C26H19F3N6O and a molecular weight of 488.47 g/mol. Its IUPAC name is N-[C-(2-amino-5-cyanophenyl)-N-phenylcarbonimidoyl]-3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-[C-(2-amino-5-cyanophenyl)-N-phenylcarbonimidoyl]-3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137036863 |
| Molecular Formula | C26H19F3N6O |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[C-(2-amino-5-cyanophenyl)-N-phenylcarbonimidoyl]-3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | Cn1ccc(-c2cc(C(=O)N/C(=N/c3ccccc3)c3cc(C#N)ccc3N)ccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C26H19F3N6O/c1-35-12-11-23(34-35)19-14-17(8-9-21(19)26(27,28)29)25(36)33-24(32-18-5-3-2-4-6-18)20-13-16(15-30)7-10-22(20)31/h2-14H,31H2,1H3,(H,32,33,36) |
| InChIKey | MDQRWBCXVMWSJD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|