C25H25F2N5O3 — CID 137036899
2-(2,6-difluorophenyl)-4-[4-[2-hydroxy-2-(oxan-4-ylamino)ethyl]anilino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol (PubChem CID 137036899) has the molecular formula C25H25F2N5O3 and a molecular weight of 481.50 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-[2-hydroxy-2-(oxan-4-ylamino)ethyl]anilino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-[2-hydroxy-2-(oxan-4-ylamino)ethyl]anilino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
|---|---|
| PubChem CID | 137036899 |
| Molecular Formula | C25H25F2N5O3 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-[2-hydroxy-2-(oxan-4-ylamino)ethyl]anilino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
| SMILES | Oc1[nH]cc2nc(-c3c(F)cccc3F)nc(Nc3ccc(CC(O)NC4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C25H25F2N5O3/c26-17-2-1-3-18(27)21(17)23-31-19-13-28-25(34)22(19)24(32-23)30-15-6-4-14(5-7-15)12-20(33)29-16-8-10-35-11-9-16/h1-7,13,16,20,28-29,33-34H,8-12H2,(H,30,31,32) |
| InChIKey | BLIYACYXTBBQIF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|