C11H21N5O9P2 — CID 137037418
[3-[[[2-amino-5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]-methylamino]methyl]-4-hydroxybutyl] phosphono hydrogen phosphate (PubChem CID 137037418) has the molecular formula C11H21N5O9P2 and a molecular weight of 429.26 g/mol. Its IUPAC name is [3-[[[2-amino-5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]-methylamino]methyl]-4-hydroxybutyl] phosphono hydrogen phosphate.
| Compound Name | [3-[[[2-amino-5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]-methylamino]methyl]-4-hydroxybutyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137037418 |
| Molecular Formula | C11H21N5O9P2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [3-[[[2-amino-5-(methylideneamino)-6-oxo-1H-pyrimidin-4-yl]-methylamino]methyl]-4-hydroxybutyl] phosphono hydrogen phosphate |
| SMILES | C=Nc1c(N(C)CC(CO)CCOP(=O)(O)OP(=O)(O)O)nc(N)[nH]c1=O |
| InChI | InChI=1S/C11H21N5O9P2/c1-13-8-9(14-11(12)15-10(8)18)16(2)5-7(6-17)3-4-24-27(22,23)25-26(19,20)21/h7,17H,1,3-6H2,2H3,(H,22,23)(H2,19,20,21)(H3,12,14,15,18) |
| InChIKey | XZEGNMWVHKIKIO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 220.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|