C21H22N6 — CID 137041220
4-(4-methylpiperazin-1-yl)-2-(3-pyridin-4-yl-1H-pyrazol-5-yl)-1H-indole (PubChem CID 137041220) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-2-(3-pyridin-4-yl-1H-pyrazol-5-yl)-1H-indole.
| Compound Name | 4-(4-methylpiperazin-1-yl)-2-(3-pyridin-4-yl-1H-pyrazol-5-yl)-1H-indole |
|---|---|
| PubChem CID | 137041220 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-2-(3-pyridin-4-yl-1H-pyrazol-5-yl)-1H-indole |
| SMILES | CN1CCN(c2cccc3[nH]c(-c4cc(-c5ccncc5)n[nH]4)cc23)CC1 |
| InChI | InChI=1S/C21H22N6/c1-26-9-11-27(12-10-26)21-4-2-3-17-16(21)13-19(23-17)20-14-18(24-25-20)15-5-7-22-8-6-15/h2-8,13-14,23H,9-12H2,1H3,(H,24,25) |
| InChIKey | OMWBSWXIMYVRJL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |