C18H13Cl3N4O2 — CID 137042744
(7S)-7-[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 137042744) has the molecular formula C18H13Cl3N4O2 and a molecular weight of 423.69 g/mol. Its IUPAC name is (7S)-7-[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | (7S)-7-[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137042744 |
| Molecular Formula | C18H13Cl3N4O2 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | (7S)-7-[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=C1C[C@@H](c2cc(Cl)c(OCc3ccc(Cl)cc3)c(Cl)c2)n2ncnc2N1 |
| InChI | InChI=1S/C18H13Cl3N4O2/c19-12-3-1-10(2-4-12)8-27-17-13(20)5-11(6-14(17)21)15-7-16(26)24-18-22-9-23-25(15)18/h1-6,9,15H,7-8H2,(H,22,23,24,26)/t15-/m0/s1 |
| InChIKey | KIGGFKNZWNFDGF-HNNXBMFYSA-N |
| XLogP | 4.75 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |