About N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine
N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine (PubChem CID 137043003) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine.
Molecular Properties
| Compound Name | N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine |
| PubChem CID | 137043003 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine |
| SMILES | C/N=C1\CCC=C(C)N1 |
| InChI | InChI=1S/C7H12N2/c1-6-4-3-5-7(8-2)9-6/h4H,3,5H2,1-2H3,(H,8,9) |
| InChIKey | WOBANUOURGMPON-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine?
The IUPAC name of N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine (CID 137043003) is N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine.
What is the SMILES notation for N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine?
The canonical SMILES for N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine is C/N=C1\CCC=C(C)N1.
What is the InChIKey of N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine?
The InChIKey is WOBANUOURGMPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-6-4-3-5-7(8-2)9-6/h4H,3,5H2,1-2H3,(H,8,9).
What are the key properties of N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine?
N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine has a molecular weight of 124.19 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethyl-3,4-dihydro-1H-pyridin-2-imine is sourced from PubChem (CID 137043003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).