About 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one
3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137043841) has the molecular formula C9H11BrN4O
and a molecular weight of 271.12 g/mol. Its IUPAC name is 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 137043841 |
| Molecular Formula | C9H11BrN4O |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC[C@H](C)n1nc(Br)c2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C9H11BrN4O/c1-3-5(2)14-8-6(7(10)13-14)9(15)12-4-11-8/h4-5H,3H2,1-2H3,(H,11,12,15)/t5-/m0/s1 |
| InChIKey | JKXZNIISSANDFZ-YFKPBYRVSA-N |
| XLogP | 1.85 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 137043841) is 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one is CC[C@H](C)n1nc(Br)c2c(=O)[nH]cnc21.
What is the InChIKey of 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is JKXZNIISSANDFZ-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H11BrN4O/c1-3-5(2)14-8-6(7(10)13-14)9(15)12-4-11-8/h4-5H,3H2,1-2H3,(H,11,12,15)/t5-/m0/s1.
What are the key properties of 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 271.12 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[(2S)-butan-2-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 137043841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).