C25H21BrN2O4S — CID 137043919
methyl 4-[5-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate (PubChem CID 137043919) has the molecular formula C25H21BrN2O4S and a molecular weight of 525.42 g/mol. Its IUPAC name is methyl 4-[5-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[5-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 137043919 |
| Molecular Formula | C25H21BrN2O4S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | methyl 4-[5-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C3\S/C(=N/c4cc(C)c(Br)c(C)c4)NC3=O)o2)c(C)c1 |
| InChI | InChI=1S/C25H21BrN2O4S/c1-13-9-16(24(30)31-4)5-7-19(13)20-8-6-18(32-20)12-21-23(29)28-25(33-21)27-17-10-14(2)22(26)15(3)11-17/h5-12H,1-4H3,(H,27,28,29)/b21-12- |
| InChIKey | MEJUKGQTLKAYQQ-MTJSOVHGSA-N |
| XLogP | 6.31 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|