About 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol
4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol (PubChem CID 137045534) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol |
| PubChem CID | 137045534 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol |
| SMILES | CCc1ccc(-c2cc(-c3ccc(O)cc3)no2)cc1 |
| InChI | InChI=1S/C17H15NO2/c1-2-12-3-5-14(6-4-12)17-11-16(18-20-17)13-7-9-15(19)10-8-13/h3-11,19H,2H2,1H3 |
| InChIKey | OFYQHCBAJZXTAR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol?
The IUPAC name of 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol (CID 137045534) is 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol.
What is the SMILES notation for 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol?
The canonical SMILES for 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol is CCc1ccc(-c2cc(-c3ccc(O)cc3)no2)cc1.
What is the InChIKey of 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol?
The InChIKey is OFYQHCBAJZXTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c1-2-12-3-5-14(6-4-12)17-11-16(18-20-17)13-7-9-15(19)10-8-13/h3-11,19H,2H2,1H3.
What are the key properties of 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol?
4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol has a molecular weight of 265.31 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-ethylphenyl)-1,2-oxazol-3-yl]phenol is sourced from PubChem (CID 137045534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).