C6H11N3OS — CID 137046124
3-tert-butylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137046124) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-tert-butylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-tert-butylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137046124 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-tert-butylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC(C)(C)Sc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H11N3OS/c1-6(2,3)11-5-7-4(10)8-9-5/h1-3H3,(H2,7,8,9,10) |
| InChIKey | NKAHVJQRAHWNQS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |