C21H20F2N6O2 — CID 137046217
2-(2,6-difluorophenyl)-4-[[6-[2-(ethylamino)-2-hydroxyethyl]-3-pyridinyl]amino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol (PubChem CID 137046217) has the molecular formula C21H20F2N6O2 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[[6-[2-(ethylamino)-2-hydroxyethyl]-3-pyridinyl]amino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol.
| Compound Name | 2-(2,6-difluorophenyl)-4-[[6-[2-(ethylamino)-2-hydroxyethyl]-3-pyridinyl]amino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
|---|---|
| PubChem CID | 137046217 |
| Molecular Formula | C21H20F2N6O2 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[[6-[2-(ethylamino)-2-hydroxyethyl]-3-pyridinyl]amino]-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
| SMILES | CCNC(O)Cc1ccc(Nc2nc(-c3c(F)cccc3F)nc3c[nH]c(O)c23)cn1 |
| InChI | InChI=1S/C21H20F2N6O2/c1-2-24-16(30)8-11-6-7-12(9-25-11)27-20-18-15(10-26-21(18)31)28-19(29-20)17-13(22)4-3-5-14(17)23/h3-7,9-10,16,24,26,30-31H,2,8H2,1H3,(H,27,28,29) |
| InChIKey | OIYSONQFFWOZQG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|