C25H39N11O — CID 137047030
6-[[4-amino-2-[2-(furan-2-yl)ethylimino]-1,3,6,7-tetrahydro-1,3,5-triazepin-7-yl]methyl]-2-N,4-N,4-N,7-tetramethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine (PubChem CID 137047030) has the molecular formula C25H39N11O and a molecular weight of 509.66 g/mol. Its IUPAC name is 6-[[4-amino-2-[2-(furan-2-yl)ethylimino]-1,3,6,7-tetrahydro-1,3,5-triazepin-7-yl]methyl]-2-N,4-N,4-N,7-tetramethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine.
| Compound Name | 6-[[4-amino-2-[2-(furan-2-yl)ethylimino]-1,3,6,7-tetrahydro-1,3,5-triazepin-7-yl]methyl]-2-N,4-N,4-N,7-tetramethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine |
|---|---|
| PubChem CID | 137047030 |
| Molecular Formula | C25H39N11O |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 6-[[4-amino-2-[2-(furan-2-yl)ethylimino]-1,3,6,7-tetrahydro-1,3,5-triazepin-7-yl]methyl]-2-N,4-N,4-N,7-tetramethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]-6,7-dihydro-3H-1,3,5-triazepine-2,4-diamine |
| SMILES | CC1N=C(N(C)CCc2ccc[nH]2)NC(N(C)C)=NC1CC1CN=C(N)N/C(=N\CCc2ccco2)N1 |
| InChI | InChI=1S/C25H39N11O/c1-17-21(15-19-16-29-22(26)33-23(31-19)28-12-9-20-8-6-14-37-20)32-24(35(2)3)34-25(30-17)36(4)13-10-18-7-5-11-27-18/h5-8,11,14,17,19,21,27H,9-10,12-13,15-16H2,1-4H3,(H,30,32,34)(H4,26,28,29,31,33) |
| InChIKey | NDBOWNRWZGHYPQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|