C10H18N6O2 — CID 137047037
N'-hydroxy-4-[(1-methylpiperidin-4-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137047037) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is N'-hydroxy-4-[(1-methylpiperidin-4-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-hydroxy-4-[(1-methylpiperidin-4-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137047037 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N'-hydroxy-4-[(1-methylpiperidin-4-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CN1CCC(CNc2nonc2C(N)=NO)CC1 |
| InChI | InChI=1S/C10H18N6O2/c1-16-4-2-7(3-5-16)6-12-10-8(9(11)13-17)14-18-15-10/h7,17H,2-6H2,1H3,(H2,11,13)(H,12,15) |
| InChIKey | ZDKPIJLEBYEAMC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|