C22H18BrN3OS — CID 137047389
(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137047389) has the molecular formula C22H18BrN3OS and a molecular weight of 452.38 g/mol. Its IUPAC name is (5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137047389 |
| Molecular Formula | C22H18BrN3OS |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\NC(=O)/C(=C/c3cccn3-c3cccc(Br)c3)S2)cc1 |
| InChI | InChI=1S/C22H18BrN3OS/c1-2-15-8-10-17(11-9-15)24-22-25-21(27)20(28-22)14-19-7-4-12-26(19)18-6-3-5-16(23)13-18/h3-14H,2H2,1H3,(H,24,25,27)/b20-14- |
| InChIKey | SMTINAXHUOJJQV-ZHZULCJRSA-N |
| XLogP | 5.69 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|