C32H46N2O2 — CID 137047481
2-[[3-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dipropylphenol (PubChem CID 137047481) has the molecular formula C32H46N2O2 and a molecular weight of 490.73 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dipropylphenol.
| Compound Name | 2-[[3-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dipropylphenol |
|---|---|
| PubChem CID | 137047481 |
| Molecular Formula | C32H46N2O2 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | 2-[[3-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]cyclohexyl]iminomethyl]-4,6-dipropylphenol |
| SMILES | CCCc1cc(/C=N/C2CCCC(/N=C/c3cc(CCC)cc(CCC)c3O)C2)c(O)c(CCC)c1 |
| InChI | InChI=1S/C32H46N2O2/c1-5-10-23-16-25(12-7-3)31(35)27(18-23)21-33-29-14-9-15-30(20-29)34-22-28-19-24(11-6-2)17-26(13-8-4)32(28)36/h16-19,21-22,29-30,35-36H,5-15,20H2,1-4H3/b33-21+,34-22+ |
| InChIKey | VYDMHTKABJAQAH-WXGDAXOSSA-N |
| XLogP | 7.76 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|