C5H6N6O2 — CID 137048080
(6E,7R)-7-amino-6-hydroxyimino-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 137048080) has the molecular formula C5H6N6O2 and a molecular weight of 182.14 g/mol. Its IUPAC name is (6E,7R)-7-amino-6-hydroxyimino-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | (6E,7R)-7-amino-6-hydroxyimino-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137048080 |
| Molecular Formula | C5H6N6O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (6E,7R)-7-amino-6-hydroxyimino-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | N[C@H]1/C(=N\O)C(=O)Nc2ncnn21 |
| InChI | InChI=1S/C5H6N6O2/c6-3-2(10-13)4(12)9-5-7-1-8-11(3)5/h1,3,13H,6H2,(H,7,8,9,12)/b10-2+/t3-/m1/s1 |
| InChIKey | FOASGPXDLWFKEG-NSSOCOSKSA-N |
| XLogP | -1.48 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|