C9H13N5O5 — CID 137048091
ethyl (2S)-2-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]propanoate (PubChem CID 137048091) has the molecular formula C9H13N5O5 and a molecular weight of 271.23 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]propanoate.
| Compound Name | ethyl (2S)-2-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 137048091 |
| Molecular Formula | C9H13N5O5 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | ethyl (2S)-2-[(2-amino-5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)Nc1nc(N)[nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O5/c1-3-19-8(16)4(2)11-6-5(14(17)18)7(15)13-9(10)12-6/h4H,3H2,1-2H3,(H4,10,11,12,13,15)/t4-/m0/s1 |
| InChIKey | CMDSZFWHAZICQK-BYPYZUCNSA-N |
| XLogP | -0.38 |
| TPSA | 153.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|