C18H19F3N6O3 — CID 137049079
2-[5-methyl-4-[4-(2,2,2-trifluoroethoxy)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 137049079) has the molecular formula C18H19F3N6O3 and a molecular weight of 424.38 g/mol. Its IUPAC name is 2-[5-methyl-4-[4-(2,2,2-trifluoroethoxy)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-methyl-4-[4-(2,2,2-trifluoroethoxy)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137049079 |
| Molecular Formula | C18H19F3N6O3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[5-methyl-4-[4-(2,2,2-trifluoroethoxy)piperidine-1-carbonyl]pyrazol-1-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1c(C(=O)N2CCC(OCC(F)(F)F)CC2)cnn1-c1nn2cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H19F3N6O3/c1-11-13(16(29)25-7-4-12(5-8-25)30-10-18(19,20)21)9-22-27(11)17-23-15(28)14-3-2-6-26(14)24-17/h2-3,6,9,12H,4-5,7-8,10H2,1H3,(H,23,24,28) |
| InChIKey | ASYGPIQTBPKWOH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |